Drugs present in MMsINC which are similar to the molecule MMscode: MMs03958970
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726609![]() | Ic1c(C(O)=O)c(I)c(NC(=O)C)cc1NC(=O)C | 0.76 |
MMs01727015![]() | Ic1c(C(O)=O)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.71 |
MMs01724841![]() | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.71 |
MMs01726675![]() | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.71 |
MMs01726677![]() | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.71 |