Drugs present in MMsINC which are similar to the molecule MMscode: MMs03951127
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725932![]() | O(CC(C)C)CC(N1CCCC1)CN(Cc1ccccc1)c1ccccc1 | 0.74 |
MMs01726073![]() | O(CC(C)C)CC(N1CCCC1)CN(Cc1ccccc1)c1ccccc1 | 0.74 |
MMs01725425![]() | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.71 |
MMs01724790![]() | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.71 |
MMs01725317![]() | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.71 |