Drugs present in MMsINC which are similar to the molecule MMscode: MMs03925188
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725047 | S(=O)(=O)(Nc1ncc(OC)cn1)c1ccc(N)cc1 | 0.81 |
MMs01724990 | S(=O)(=O)(NC(=O)NC(C)C)c1cnccc1Nc1cc(ccc1)C | 0.74 |
MMs01724933 | S(=O)(=O)(Nc1nc(nc(OC)c1)C)c1ccc(N)cc1 | 0.74 |
MMs01724931 | S(=O)(=O)(Nc1ncnc(OC)c1OC)c1ccc(N)cc1 | 0.72 |
MMs01725814 | s1cccc1CN(CCN(C)C)c1ncccc1 | 0.72 |
MMs01725013 | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.70 |
MMs01725694 | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.70 |