Drugs present in MMsINC which are similar to the molecule MMscode: MMs03921673
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725125 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.82 |
MMs01725127 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.82 |
MMs01727505 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(OP(OP(O)(O)=O)(O)=O)(O)=O | 0.71 |
MMs01727507 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(OP(OP(O)(O)=O)(O)=O)(O)=O | 0.71 |
MMs01725834 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.70 |
MMs01725836 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.70 |