Drugs present in MMsINC which are similar to the molecule MMscode: MMs03876859
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725108 | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.72 |
MMs01725292 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.72 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.72 |
MMs01724751 | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.72 |
MMs01725619 | O(C(=O)C(C)C)c1cc(ccc1OC(=O)C(C)C)CCNC | 0.71 |
MMs01725448 | Oc1cc(ccc1O)CC(N)C(O)=O | 0.71 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01725897 | O(C)c1cc(C)c(\C=C\C(=C/C=C/C(=C\C(O)=O)/C)\C)c(C)c1C | 0.70 |