Drugs present in MMsINC which are similar to the molecule MMscode: MMs03842752
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.71 |
MMs01725029 | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.71 |
MMs01724795 | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.71 |
MMs01726900 | Oc1cc2C34C(C(N(CC3)CC=C)Cc2cc1)CCCC4 | 0.70 |
MMs01725002 | Oc1c-2c(CC3N(CCc4c3c-2ccc4)C)ccc1O | 0.70 |
MMs01727414 | OC12C(CC3C(C1=O)C(=O)c1c(cccc1O)C3(O)C)C(N(C)C)C(=O)C(C(=O)N)C2=O | 0.70 |
MMs01727419 | OC12C(CC3C(C1=O)C(=O)c1c(cccc1O)C3(O)C)C(N(C)C)C(=O)C(C(=O)N)C2=O | 0.70 |