Drugs present in MMsINC which are similar to the molecule MMscode: MMs03828067
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726842 | OC1Cc2c(cccc2)C1NC(=O)C(Cc1ccccc1)CC(O)CN1CCN(CC1C(=O)NC(C)(C)C)Cc1cccnc1 | 0.72 |
MMs01726844 | OC1Cc2c(cccc2)C1NC(=O)C(Cc1ccccc1)CC(O)CN1CCN(CC1C(=O)NC(C)(C)C)Cc1cccnc1 | 0.72 |
MMs01727137 | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.70 |
MMs01727138 | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.70 |
MMs01727139 | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.70 |
MMs01727140 | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.70 |