Drugs present in MMsINC which are similar to the molecule MMscode: MMs03799201
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725207 | S(=O)(Cc1nccc(OCC(F)(F)F)c1C)c1[nH]c2c(n1)cccc2 | 0.73 |
MMs01725413 | S(=O)(Cc1ncc(C)c(OC)c1C)c1[nH]c2c(n1)cc(OC)cc2 | 0.73 |
MMs01725868 | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.72 |
MMs01727026 | Fc1cc2c(cc1)C(C(C)C)C(OC(=O)COC)(CC2)CCN(CCCc1[nH]c2c(n1)cccc2)C | 0.72 |
MMs01725206 | O(C)c1c(OC)cc(NCc2ccc3nc(nc(N)c3c2C)N)cc1OC | 0.71 |
MMs01725466 | O(CCNCC(O)COc1c2c3c([nH]c2ccc1)cccc3)c1ccccc1OC | 0.70 |
MMs01725468 | O(CCNCC(O)COc1c2c3c([nH]c2ccc1)cccc3)c1ccccc1OC | 0.70 |