Drugs present in MMsINC which are similar to the molecule MMscode: MMs03793272
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725833![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.73 |
MMs01725954![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.73 |
MMs01725809![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.73 |
MMs01725956![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.73 |
MMs01727308![]() | O1C(CO)C(O)C(O)C1n1nc(nc1)C(=O)N | 0.72 |
MMs01727312![]() | O1C(CO)C(O)C(O)C1n1nc(nc1)C(=O)N | 0.72 |
MMs01727307![]() | O1C(CO)C(O)C(O)C1n1nc(nc1)C(=O)N | 0.72 |
MMs01727310![]() | O1C(CO)C(O)C(O)C1n1nc(nc1)C(=O)N | 0.72 |
MMs01727537![]() | O1C(CO)C(O)CC1n1c2N=CNCC(O)c2nc1 | 0.72 |
MMs01727206![]() | O1C(CO)C(O)CC1n1c2N=CNCC(O)c2nc1 | 0.72 |
MMs01727207![]() | O1C(CO)C(O)CC1n1c2N=CNCC(O)c2nc1 | 0.72 |