Drugs present in MMsINC which are similar to the molecule MMscode: MMs03782947
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725044 | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.87 |
MMs01725045 | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.87 |
MMs01725046 | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.87 |
MMs01725414 | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.76 |
MMs01727493 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.72 |
MMs01727494 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.72 |
MMs01727495 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.72 |
MMs01727496 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.72 |