Drugs present in MMsINC which are similar to the molecule MMscode: MMs03779768
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727493 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.97 |
MMs01727494 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.97 |
MMs01727495 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.97 |
MMs01727496 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.97 |
MMs01725149 | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.81 |
MMs01726757 | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.81 |
MMs01725126 | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.81 |