Drugs present in MMsINC which are similar to the molecule MMscode: MMs03758767
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.76 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.76 |
MMs01725132![]() | O(C(=O)C(CO)c1ccccc1)C1CC2[N+]([O-])(C(C1)CC2)C | 0.76 |
MMs01725749![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.74 |
MMs01724873![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.74 |
MMs01725745![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.74 |
MMs01725747![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.74 |
MMs01724752![]() | O(C(=O)C1(CCCN(CC1)C)c1ccccc1)CC | 0.73 |
MMs01725182![]() | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.70 |
MMs01727430![]() | s1ccc(C)c1C(=CCCN1CC(CCC1)C(O)=O)c1sccc1C | 0.70 |