Drugs present in MMsINC which are similar to the molecule MMscode: MMs03727956
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.78 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.78 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.78 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.78 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.78 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.78 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.77 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.75 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.74 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01725075 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.71 |
MMs01725073 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.71 |
MMs01724814 | Oc1cc(cc(O)c1)C(O)CNC(C)(C)C | 0.70 |