Drugs present in MMsINC which are similar to the molecule MMscode: MMs03724605
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726869 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.76 |
MMs01726873 | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.76 |
MMs01726872 | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.76 |
MMs01726870 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.76 |
MMs01726871 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.76 |
MMs01726868 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.76 |
MMs01724997 | S(=O)(=O)(C)c1ccc(cc1)C=1COC(=O)C=1c1ccccc1 | 0.76 |
MMs01727385 | S(=O)(C)c1ccc(cc1)\C=C/1\c2c(cc(F)cc2)C(CC(O)=O)=C\1C | 0.74 |
MMs01724957 | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.71 |
MMs01724816 | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.71 |
MMs01724995 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.71 |
MMs01727042 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.71 |
MMs01725712 | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.70 |