Drugs present in MMsINC which are similar to the molecule MMscode: MMs03714402
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.75 |
MMs01725390 | [NH+](CCC=C1c2c(CCc3c1cccc3)cccc2)(C)C | 0.72 |
MMs01725433 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.72 |
MMs01725794 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.72 |
MMs01725715 | O(CCCN(C)C)C1(CCCCCC1)Cc1ccccc1 | 0.71 |
MMs01725536 | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.71 |