Drugs present in MMsINC which are similar to the molecule MMscode: MMs03712606
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725176 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.73 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.72 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.72 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |