Drugs present in MMsINC which are similar to the molecule MMscode: MMs03702780
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725844 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.74 |
MMs01725609 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.74 |
MMs01725846 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.74 |
MMs01725842 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.74 |
MMs01727210 | S(CC1CC2C([NH+](C1)CCC)Cc1c3c2cccc3[nH]c1)C | 0.72 |
MMs01727208 | S(CC1CC2C([NH+](C1)CCC)Cc1c3c2cccc3[nH]c1)C | 0.72 |
MMs01724967 | S(=O)(=O)(NC)CCc1cc2c([nH]cc2C2CCN(CC2)C)cc1 | 0.72 |
MMs01727005 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |
MMs01727007 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |
MMs01727009 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |
MMs01725678 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.71 |