Drugs present in MMsINC which are similar to the molecule MMscode: MMs03692929
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725309![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01724901![]() | O(C(=O)C1(CCN(CC1)C)c1ccccc1)CC | 0.72 |
MMs01725132![]() | O(C(=O)C(CO)c1ccccc1)C1CC2[N+]([O-])(C(C1)CC2)C | 0.71 |
MMs01725231![]() | OC(=O)C1(CCN(CC1)CCC(C#N)(c1ccccc1)c1ccccc1)c1ccccc1 | 0.71 |
MMs01725848![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.71 |
MMs01725647![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.71 |
MMs01726642![]() | O(C(=O)C1(CCN(CC1)CCC(C#N)(c1ccccc1)c1ccccc1)c1ccccc1)CC | 0.70 |
MMs01725640![]() | O(C(=O)C1(CCCN(CC1)C)c1ccccc1)CC | 0.70 |
MMs01724752![]() | O(C(=O)C1(CCCN(CC1)C)c1ccccc1)CC | 0.70 |