Drugs present in MMsINC which are similar to the molecule MMscode: MMs03678497
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727047 | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.76 |
MMs01727049 | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.76 |
MMs01727043 | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.76 |
MMs01727045 | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.76 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.73 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.73 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.73 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.73 |
MMs01724795 | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.72 |
MMs01727511 | O(C(=O)C(CO)c1ccccc1)C1CC2[N+](C(C1)CC2)(Cc1ccc(OCCCC)cc1)C | 0.72 |
MMs01726520 | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.71 |
MMs01724867 | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.71 |