Drugs present in MMsINC which are similar to the molecule MMscode: MMs03673930
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725874 | Oc1ccc(cc1CO)C(O)CNCCCCCCOCCCCc1ccccc1 | 0.73 |
MMs01725911 | Oc1ccc(cc1CO)C(O)CNCCCCCCOCCCCc1ccccc1 | 0.73 |
MMs01726882 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.72 |
MMs01726884 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.72 |
MMs01726886 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.72 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.72 |
MMs01725372 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01724917 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01727222 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01727220 | O1CCN(C)C(C)C1c1ccccc1 | 0.71 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |