Drugs present in MMsINC which are similar to the molecule MMscode: MMs03626138
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725602 | P(O)(O)(=O)C(P(O)(O)=O)(O)Cc1cccnc1 | 0.77 |
MMs01724766 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.73 |
MMs01725701 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.73 |
MMs01724886 | S=C(N)c1cc(ncc1)CC | 0.73 |
MMs01727136 | O(C(=O)c1cccnc1)CC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 | 0.73 |