Drugs present in MMsINC which are similar to the molecule MMscode: MMs03620762
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725511 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.75 |
MMs01725513 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.75 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |