Drugs present in MMsINC which are similar to the molecule MMscode: MMs03620077
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725077 | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.76 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01724814 | Oc1cc(cc(O)c1)C(O)CNC(C)(C)C | 0.74 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.73 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.73 |
MMs01725874 | Oc1ccc(cc1CO)C(O)CNCCCCCCOCCCCc1ccccc1 | 0.72 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.71 |
MMs01725087 | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01724795 | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.71 |
MMs01725388 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.71 |
MMs01725376 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.71 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.70 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.70 |