Drugs present in MMsINC which are similar to the molecule MMscode: MMs03547550
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727457 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.74 |
MMs01727458 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.74 |
MMs01727459 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.74 |
MMs01727460 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.74 |
MMs01725154 | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.73 |
MMs01725859 | Oc1c(O)c(c2c(cc(C)c(-c3c(cc4c(c(C=O)c(O)c(O)c4C(C)C)c3O)C)c2O)c1C(C)C)C=O | 0.72 |