Drugs present in MMsINC which are similar to the molecule MMscode: MMs03541316
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724834 | Clc1cc2c(-n3c(nnc3C)CN=C2c2ccccc2)cc1 | 0.85 |
MMs01724884 | Clc1cc2c(-n3c(nnc3)CN=C2c2ccccc2)cc1 | 0.84 |
MMs01724907 | Clc1cc2c(-n3c(CN=C2c2ccccc2F)c[nH+]c3C)cc1 | 0.75 |
MMs01724887 | Clc1ccccc1C1=NCc2n(-c3sc(cc13)CC)c(nn2)C | 0.72 |
MMs01724924 | Clc1cc2c(N(CC3CC3)C(=O)CN=C2c2ccccc2)cc1 | 0.71 |