Drugs present in MMsINC which are similar to the molecule MMscode: MMs03538054
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725073 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.77 |
MMs01725075 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.77 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.72 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.72 |
MMs01725176 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.71 |