Drugs present in MMsINC which are similar to the molecule MMscode: MMs03537749
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724751 | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.76 |
MMs01725448 | Oc1cc(ccc1O)CC(N)C(O)=O | 0.76 |
MMs01725139 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.75 |
MMs01725137 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.75 |
MMs01724767 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.75 |
MMs01725108 | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.73 |
MMs01726749 | FC(F)(F)COc1ccc(OCC(F)(F)F)cc1C(=O)NCC1NCCCC1 | 0.71 |