Drugs present in MMsINC which are similar to the molecule MMscode: MMs03524347
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724900 | Oc1c2c(cccc2)c(O)cc1C | 0.89 |
MMs01726706 | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.76 |
MMs01726704 | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.76 |
MMs01725451 | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.76 |
MMs01726708 | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.76 |
MMs01725154 | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.73 |
MMs01726687 | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.73 |
MMs01724776 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.73 |
MMs01725340 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.73 |
MMs01726710 | OC1(CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3)C#C | 0.73 |
MMs01726711 | OC1(CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3)C#C | 0.73 |
MMs01726712 | OC1(CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3)C#C | 0.73 |
MMs01726713 | OC1(CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3)C#C | 0.73 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.72 |
MMs01725897 | O(C)c1cc(C)c(\C=C\C(=C/C=C/C(=C\C(O)=O)/C)\C)c(C)c1C | 0.72 |