Drugs present in MMsINC which are similar to the molecule MMscode: MMs03504201
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726565 | Clc1c2c(C(=O)C3C(CC4C(O)(C(=O)C(C(=O)N)C(=O)C4N(C)C)C3=O)C2O)c(O)cc1 | 0.74 |
MMs01726560 | Clc1c2c(C(=O)C3C(CC4C(O)(C(=O)C(C(=O)N)C(=O)C4N(C)C)C3=O)C2O)c(O)cc1 | 0.74 |
MMs01726555 | Clc1c2c(C(=O)C3C(CC4C(O)(C(=O)C(C(=O)N)C(=O)C4N(C)C)C3=O)C2O)c(O)cc1 | 0.74 |
MMs01726570 | Clc1c2c(C(=O)C3C(CC4C(O)(C(=O)C(C(=O)N)=C(O)C4N(C)C)C3=O)C2O)c(O)cc1 | 0.74 |
MMs01724767 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.73 |
MMs01725137 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.73 |
MMs01725139 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.73 |
MMs01726447 | Clc1c2c(C(=O)C3C(CC4C(O)(C(=O)C(C(=O)N)C(=O)C4N(C)C)C3=O)C2(O)C)c(O)cc1 | 0.73 |
MMs01726442 | Clc1c2c(C(=O)C3C(CC4C(O)(C(=O)C(C(=O)N)C(=O)C4N(C)C)C3=O)C2(O)C)c(O)cc1 | 0.73 |
MMs01726437 | Clc1c2c(C(=O)C3C(CC4C(O)(C(=O)C(C(=O)N)C(=O)C4N(C)C)C3=O)C2(O)C)c(O)cc1 | 0.73 |
MMs01726432 | Clc1c2c(C(=O)C3C(CC4C(O)(C(=O)C(C(=O)N)C(=O)C4N(C)C)C3=O)C2(O)C)c(O)cc1 | 0.73 |