Drugs present in MMsINC which are similar to the molecule MMscode: MMs03492247
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01726669 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01725949 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01726673 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01726671 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01727287 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.70 |
MMs01725749 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725747 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725745 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01724873 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |