Drugs present in MMsINC which are similar to the molecule MMscode: MMs03448974
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727028![]() | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.83 |
MMs01727029![]() | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.83 |
MMs01727030![]() | OC1(CCC2C3C(=C4C(=CC(=O)CC4)CC3)C(CC12C)c1ccc(N(C)C)cc1)C#CC | 0.83 |
MMs01727717![]() | OC1[N+]2(C3C4C(CC2C2N(c5c(C2(C3)C4O)cccc5)C)C1CC)CCC | 0.71 |
MMs01727718![]() | OC1[N+]2(C3C4C(CC2C2N(c5c(C2(C3)C4O)cccc5)C)C1CC)CCC | 0.71 |