Drugs present in MMsINC which are similar to the molecule MMscode: MMs03440141
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725672 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.74 |
MMs01725798 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.74 |
MMs01725225 | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.73 |
MMs01727381 | S(=O)(CCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1)c1ccccc1 | 0.73 |
MMs01724890 | O=C1N(N(C(=O)C1CC=C(C)C)c1ccccc1)c1ccccc1 | 0.72 |