Drugs present in MMsINC which are similar to the molecule MMscode: MMs03436042
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727180 | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.72 |
MMs01727179 | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.72 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.71 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.71 |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.71 |
MMs01726777 | Clc1cc2c(N(CCO)C(=O)CN3CCOC23c2ccccc2F)cc1 | 0.70 |
MMs01725075 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.70 |
MMs01725073 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.70 |