Drugs present in MMsINC which are similar to the molecule MMscode: MMs03432021
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725185 | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.78 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.76 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.76 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725118 | O(C(=O)C(O)(c1ccccc1)c1ccccc1)CCN1CCCCC1 | 0.71 |