Drugs present in MMsINC which are similar to the molecule MMscode: MMs03405341
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727245 | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.71 |
MMs01727247 | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.71 |
MMs01727249 | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.71 |
MMs01727251 | O(C(=O)C(CC)C)C1C2C(=CC(O)C1)C=CC(C)C2CCC(O)CC(O)CC(O)=O | 0.71 |
MMs01727410 | O1C2(C(C3C(CC2)C2(C(=CC(=O)C=C2)CC3)C)CCC1=O)C | 0.71 |
MMs01727411 | O1C2(C(C3C(CC2)C2(C(=CC(=O)C=C2)CC3)C)CCC1=O)C | 0.71 |
MMs01727412 | O1C2(C(C3C(CC2)C2(C(=CC(=O)C=C2)CC3)C)CCC1=O)C | 0.71 |
MMs01727413 | O1C2(C(C3C(CC2)C2(C(=CC(=O)C=C2)CC3)C)CCC1=O)C | 0.71 |