Drugs present in MMsINC which are similar to the molecule MMscode: MMs03384886
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.80 |
MMs01725704 | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.76 |
MMs01727349 | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.76 |
MMs01727347 | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.76 |
MMs01724853 | Clc1cc(NC(=[NH2+])NC(=[NH2+])NC(C)C)ccc1Cl | 0.74 |
MMs01724851 | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.71 |
MMs01725291 | Clc1cccc(Cl)c1N=C1NCCN1 | 0.70 |
MMs01725157 | Clc1ccc(cc1)C1(CCC1)C([NH+](C)C)CC(C)C | 0.70 |
MMs01724976 | Clc1ccc(cc1)C1(CCC1)C([NH+](C)C)CC(C)C | 0.70 |