Drugs present in MMsINC which are similar to the molecule MMscode: MMs03377188
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726794![]() | O1C(O)(CO)C(O)C(O)C1CO | 0.80 |
MMs01726796![]() | O1C(O)(CO)C(O)C(O)C1CO | 0.80 |
MMs01726798![]() | O1C(O)(CO)C(O)C(O)C1CO | 0.80 |
MMs01726800![]() | O1C(O)(CO)C(O)C(O)C1CO | 0.80 |
MMs01727445![]() | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.72 |
MMs01727446![]() | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.72 |
MMs01727447![]() | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.72 |
MMs01727448![]() | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.72 |