Drugs present in MMsINC which are similar to the molecule MMscode: MMs03364835
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726590 | OC1(CCC2C3C(C4C(CC3)=CCCC4)C(CC12CC)=C)C#C | 0.71 |
MMs01726591 | OC1(CCC2C3C(C4C(CC3)=CCCC4)C(CC12CC)=C)C#C | 0.71 |
MMs01726592 | OC1(CCC2C3C(C4C(CC3)=CCCC4)C(CC12CC)=C)C#C | 0.71 |
MMs01726593 | OC1(CCC2C3C(C4C(CC3)=CCCC4)C(CC12CC)=C)C#C | 0.71 |
MMs01727358 | OC1CCC2(C(CC=C3C4CCC(C(CC/C(=C\C)/C(C)C)C)C4(CCC23)C)C1C)C | 0.70 |
MMs01727359 | OC1CCC2(C(CC=C3C4CCC(C(CC/C(=C\C)/C(C)C)C)C4(CCC23)C)C1C)C | 0.70 |
MMs01727360 | OC1CCC2(C(CC=C3C4CCC(C(CC/C(=C\C)/C(C)C)C)C4(CCC23)C)C1C)C | 0.70 |