Drugs present in MMsINC which are similar to the molecule MMscode: MMs03363341
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724873![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725745![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725747![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725749![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01726106![]() | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.70 |
MMs01726108![]() | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.70 |