Drugs present in MMsINC which are similar to the molecule MMscode: MMs03340239
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.76 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.75 |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.75 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.75 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.72 |
MMs01725564 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.71 |
MMs01725565 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.71 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.71 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.71 |
MMs01725331 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.70 |
MMs01725712 | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.70 |
MMs01725017 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.70 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.70 |