Drugs present in MMsINC which are similar to the molecule MMscode: MMs03336161
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724766 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.81 |
MMs01725701 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.81 |
MMs01725615 | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.76 |
MMs01725779 | O(CC(OC(=O)c1ccccc1)CNC(C)(C)C)c1c2cc([nH]c2ccc1)C | 0.76 |
MMs01725112 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.76 |
MMs01724747 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.76 |
MMs01725418 | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.73 |
MMs01725203 | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.73 |
MMs01725247 | O(C(=O)C1(CCN(CC1)CCc1ccc(N)cc1)c1ccccc1)CC | 0.72 |
MMs01725025 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.70 |
MMs01724998 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.70 |
MMs01725934 | S(=O)(=O)(Nc1cc(OC)c(Nc2c3c(nc4c2cccc4)cccc3)cc1)C | 0.70 |
MMs01725860 | OC(=O)\C=C\c1nc(ccc1)/C(=C\CN1CCCC1)/c1ccc(cc1)C | 0.70 |