Drugs present in MMsINC which are similar to the molecule MMscode: MMs03321949
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.74 |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.74 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.74 |
MMs01725555 | O(C(Cc1ccccc1)(C(CN(C)C)C)c1ccccc1)C(=O)CC | 0.72 |
MMs01725547 | O(C(Cc1ccccc1)(C(CN(C)C)C)c1ccccc1)C(=O)CC | 0.72 |
MMs01725551 | O(C(Cc1ccccc1)(C(CN(C)C)C)c1ccccc1)C(=O)CC | 0.72 |
MMs01725553 | O(C(Cc1ccccc1)(C(CN(C)C)C)c1ccccc1)C(=O)CC | 0.72 |
MMs01725185 | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.72 |
MMs01724901 | O(C(=O)C1(CCN(CC1)C)c1ccccc1)CC | 0.71 |