Drugs present in MMsINC which are similar to the molecule MMscode: MMs03319330
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724759![]() | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.77 |
MMs01726742![]() | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.77 |
MMs01725805![]() | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.76 |
MMs01724797![]() | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.76 |
MMs01725409![]() | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.74 |
MMs01725069![]() | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.73 |
MMs01725071![]() | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.73 |
MMs01725154![]() | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.72 |