Drugs present in MMsINC which are similar to the molecule MMscode: MMs03319150
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726838![]() | S(CCNC=N)C=1CC2N(C(=O)C2C(O)C)C=1C(O)=O | 0.81 |
MMs01726840![]() | S(CCNC=N)C=1CC2N(C(=O)C2C(O)C)C=1C(O)=O | 0.81 |
MMs01725485![]() | S1C2N(C(=O)C2NC(=O)C(N)C=2CC=CCC=2)C(C(O)=O)=C(C1)C | 0.72 |
MMs01726403![]() | S1C2N(C(=O)C2NC(=O)C(N)C=2CC=CCC=2)C(C(O)=O)=C(C1)C | 0.72 |
MMs01726405![]() | S1C2N(C(=O)C2NC(=O)C(N)C=2CC=CCC=2)C(C(O)=O)=C(C1)C | 0.72 |
MMs01726407![]() | S1C2N(C(=O)C2NC(=O)C(N)C=2CC=CCC=2)C(C(O)=O)=C(C1)C | 0.72 |