Drugs present in MMsINC which are similar to the molecule MMscode: MMs03313555
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726112![]() | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.72 |
MMs01726114![]() | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.72 |
MMs01726116![]() | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.72 |
MMs01726118![]() | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.72 |
MMs01725466![]() | O(CCNCC(O)COc1c2c3c([nH]c2ccc1)cccc3)c1ccccc1OC | 0.71 |
MMs01725468![]() | O(CCNCC(O)COc1c2c3c([nH]c2ccc1)cccc3)c1ccccc1OC | 0.71 |