Drugs present in MMsINC which are similar to the molecule MMscode: MMs03304229
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725073![]() | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.75 |
MMs01725075![]() | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.75 |
MMs01724849![]() | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.74 |
MMs01724882![]() | Oc1cc([N+](CC)(C)C)ccc1 | 0.73 |
MMs01725741![]() | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.71 |
MMs01724806![]() | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.71 |
MMs01724880![]() | ClC(Cl)C(=O)N(C)c1ccc(O)cc1 | 0.70 |
MMs01724790![]() | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.70 |