Drugs present in MMsINC which are similar to the molecule MMscode: MMs03294902
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725139 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.73 |
MMs01724767 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.73 |
MMs01724971 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.73 |
MMs01725137 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.73 |
MMs01725362 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.72 |
MMs01724830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.72 |
MMs01725364 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.72 |
MMs01725830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.72 |
MMs01725923 | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.71 |
MMs01725895 | O(CC)c1cc(ccc1C(O)=O)CC(=O)NC(CC(C)C)c1ccccc1N1CCCCC1 | 0.71 |
MMs01727297 | O(CC)c1cc(ccc1C(O)=O)CC(=O)NC(CC(C)C)c1ccccc1N1CCCCC1 | 0.71 |