Drugs present in MMsINC which are similar to the molecule MMscode: MMs03264056
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725073![]() | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.79 |
MMs01725075![]() | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.79 |
MMs01725176![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.77 |
MMs01727422![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.74 |
MMs01727424![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.74 |
MMs01725811![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.74 |
MMs01725851![]() | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.74 |
MMs01724880![]() | ClC(Cl)C(=O)N(C)c1ccc(O)cc1 | 0.70 |