Drugs present in MMsINC which are similar to the molecule MMscode: MMs03258001
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726940 | O(C)c1cc2CCC3C4CCC(O)(C#C)C4(CCC3c2cc1)C | 0.72 |
MMs01726937 | O(C)c1cc2CCC3C4CCC(O)(C#C)C4(CCC3c2cc1)C | 0.72 |
MMs01726938 | O(C)c1cc2CCC3C4CCC(O)(C#C)C4(CCC3c2cc1)C | 0.72 |
MMs01726939 | O(C)c1cc2CCC3C4CCC(O)(C#C)C4(CCC3c2cc1)C | 0.72 |
MMs01724943 | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.71 |
MMs01725753 | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.71 |
MMs01724993 | O(C)c1ccc(cc1)C(CN(C)C)C1(O)CCCCC1 | 0.70 |
MMs01725306 | O(C)c1ccc(cc1)C(CN(C)C)C1(O)CCCCC1 | 0.70 |