Drugs present in MMsINC which are similar to the molecule MMscode: MMs03217689
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726861 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.77 |
MMs01726859 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.77 |
MMs01726860 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.77 |
MMs01726862 | Ic1c(C(=O)NCC(O)CO)c(I)c(N(C(=O)C)CC(O)CO)c(I)c1C(=O)NCC(O)CO | 0.77 |
MMs01726864 | Ic1c(C(=O)NC(CO)CO)c(I)c(NC(=O)C(O)C)c(I)c1C(=O)NC(CO)CO | 0.74 |
MMs01726863 | Ic1c(C(=O)NC(CO)CO)c(I)c(NC(=O)C(O)C)c(I)c1C(=O)NC(CO)CO | 0.74 |
MMs01724876 | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.74 |